C22H25BN2O6 — CID 168920044
[(1R)-1-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxypropanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 168920044) has the molecular formula C22H25BN2O6 and a molecular weight of 424.26 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxypropanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxypropanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 168920044 |
| Molecular Formula | C22H25BN2O6 |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [(1R)-1-[[(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methoxypropanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | COC[C@H](C(=O)N[C@@H](CCCc1ccccc1)B(O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H25BN2O6/c1-31-14-18(25-21(27)16-11-5-6-12-17(16)22(25)28)20(26)24-19(23(29)30)13-7-10-15-8-3-2-4-9-15/h2-6,8-9,11-12,18-19,29-30H,7,10,13-14H2,1H3,(H,24,26)/t18-,19+/m1/s1 |
| InChIKey | KDUOVPZPHOWSPR-MOPGFXCFSA-N |
| XLogP | 0.82 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|