C20H30BN3O6 — CID 174072177
[(1R)-1-[[(2R)-3-methoxy-2-[[2-[(2R)-5-oxopyrrolidin-2-yl]acetyl]amino]propanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 174072177) has the molecular formula C20H30BN3O6 and a molecular weight of 419.29 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-3-methoxy-2-[[2-[(2R)-5-oxopyrrolidin-2-yl]acetyl]amino]propanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-3-methoxy-2-[[2-[(2R)-5-oxopyrrolidin-2-yl]acetyl]amino]propanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 174072177 |
| Molecular Formula | C20H30BN3O6 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [(1R)-1-[[(2R)-3-methoxy-2-[[2-[(2R)-5-oxopyrrolidin-2-yl]acetyl]amino]propanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | COC[C@@H](NC(=O)C[C@H]1CCC(=O)N1)C(=O)N[C@@H](CCCc1ccccc1)B(O)O |
| InChI | InChI=1S/C20H30BN3O6/c1-30-13-16(23-19(26)12-15-10-11-18(25)22-15)20(27)24-17(21(28)29)9-5-8-14-6-3-2-4-7-14/h2-4,6-7,15-17,28-29H,5,8-13H2,1H3,(H,22,25)(H,23,26)(H,24,27)/t15-,16-,17+/m1/s1 |
| InChIKey | QVMXKJHTUVUOGL-ZACQAIPSSA-N |
| XLogP | -0.69 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|