C13H24N2 — CID 168925689
(2Z,4Z)-N-[(Z)-but-1-enyl]-N-(methylideneamino)hexa-2,4-dien-3-amine;ethane (PubChem CID 168925689) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (2Z,4Z)-N-[(Z)-but-1-enyl]-N-(methylideneamino)hexa-2,4-dien-3-amine;ethane.
| Compound Name | (2Z,4Z)-N-[(Z)-but-1-enyl]-N-(methylideneamino)hexa-2,4-dien-3-amine;ethane |
|---|---|
| PubChem CID | 168925689 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (2Z,4Z)-N-[(Z)-but-1-enyl]-N-(methylideneamino)hexa-2,4-dien-3-amine;ethane |
| SMILES | C=NN(/C=C\CC)C(/C=C\C)=C\C.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-5-8-10-13(12-4)11(7-3)9-6-2;1-2/h6-10H,4-5H2,1-3H3;1-2H3/b9-6-,10-8-,11-7-; |
| InChIKey | UPXNALKXOVZJCP-QAARTPNXSA-N |
| XLogP | 4.33 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|