C25H36N5O6RbRe — CID 168932534
5-acetamido-N-ethyl-N'-[1-[2-[[(1S,4R)-4-methylcyclohexyl]methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide;rhenium;rubidium(1+) (PubChem CID 168932534) has the molecular formula C25H36N5O6RbRe and a molecular weight of 774.27 g/mol. Its IUPAC name is 5-acetamido-N-ethyl-N'-[1-[2-[[(1S,4R)-4-methylcyclohexyl]methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide;rhenium;rubidium(1+).
| Compound Name | 5-acetamido-N-ethyl-N'-[1-[2-[[(1S,4R)-4-methylcyclohexyl]methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide;rhenium;rubidium(1+) |
|---|---|
| PubChem CID | 168932534 |
| Molecular Formula | C25H36N5O6RbRe |
| Molecular Weight | 774.27 g/mol |
| Exact Mass | 774.13 |
| IUPAC Name | 5-acetamido-N-ethyl-N'-[1-[2-[[(1S,4R)-4-methylcyclohexyl]methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide;rhenium;rubidium(1+) |
| SMILES | CCNC(=O)C(=O)CCC(NC(C)=O)C(=O)Nc1cccn(CC(=O)NC[C@H]2C[CH-][C@@H](C)CC2)c1=O.[Rb+].[Re] |
| InChI | InChI=1S/C25H36N5O6.Rb.Re/c1-4-26-24(35)21(32)12-11-19(28-17(3)31)23(34)29-20-6-5-13-30(25(20)36)15-22(33)27-14-18-9-7-16(2)8-10-18;;/h5-7,13,16,18-19H,4,8-12,14-15H2,1-3H3,(H,26,35)(H,27,33)(H,28,31)(H,29,34);;/q-1;+1;/t16-,18+,19?;;/m1../s1 |
| InChIKey | YYHWFMMWJWNBEP-REGLTWBGSA-N |
| XLogP | -2.46 |
| TPSA | 155.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.27 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|