C11H10N4O — CID 168942656
4-ethanimidoyl-1,2-dihydropyrazolo[4,3-b]indol-3-one (PubChem CID 168942656) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 4-ethanimidoyl-1,2-dihydropyrazolo[4,3-b]indol-3-one.
| Compound Name | 4-ethanimidoyl-1,2-dihydropyrazolo[4,3-b]indol-3-one |
|---|---|
| PubChem CID | 168942656 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-ethanimidoyl-1,2-dihydropyrazolo[4,3-b]indol-3-one |
| SMILES | [H]/N=C(\C)n1c2ccccc2c2[nH][nH]c(=O)c21 |
| InChI | InChI=1S/C11H10N4O/c1-6(12)15-8-5-3-2-4-7(8)9-10(15)11(16)14-13-9/h2-5,12H,1H3,(H2,13,14,16)/b12-6+ |
| InChIKey | JQTNFYLBBUKMOE-WUXMJOGZSA-N |
| XLogP | 1.66 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|