C94H173N5O12 — CID 168955531
3-(diethylamino)propyl 3,5-bis[3-[bis(9-nonan-3-yloxy-9-oxononyl)amino]propylcarbamoyl]benzoate (PubChem CID 168955531) has the molecular formula C94H173N5O12 and a molecular weight of 1565.44 g/mol. Its IUPAC name is 3-(diethylamino)propyl 3,5-bis[3-[bis(9-nonan-3-yloxy-9-oxononyl)amino]propylcarbamoyl]benzoate.
| Compound Name | 3-(diethylamino)propyl 3,5-bis[3-[bis(9-nonan-3-yloxy-9-oxononyl)amino]propylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 168955531 |
| Molecular Formula | C94H173N5O12 |
| Molecular Weight | 1565.44 g/mol |
| Exact Mass | 1564.31 |
| IUPAC Name | 3-(diethylamino)propyl 3,5-bis[3-[bis(9-nonan-3-yloxy-9-oxononyl)amino]propylcarbamoyl]benzoate |
| SMILES | CCCCCCC(CC)OC(=O)CCCCCCCCN(CCCCCCCCC(=O)OC(CC)CCCCCC)CCCNC(=O)c1cc(C(=O)NCCCN(CCCCCCCCC(=O)OC(CC)CCCCCC)CCCCCCCCC(=O)OC(CC)CCCCCC)cc(C(=O)OCCCN(CC)CC)c1 |
| InChI | InChI=1S/C94H173N5O12/c1-11-21-25-45-60-84(15-5)108-88(100)64-49-37-29-33-41-53-70-98(71-54-42-34-30-38-50-65-89(101)109-85(16-6)61-46-26-22-12-2)74-57-68-95-92(104)81-78-82(80-83(79-81)94(106)107-77-59-76-97(19-9)20-10)93(105)96-69-58-75-99(72-55-43-35-31-39-51-66-90(102)110-86(17-7)62-47-27-23-13-3)73-56-44-36-32-40-52-67-91(103)111-87(18-8)63-48-28-24-14-4/h78-80,84-87H,11-77H2,1-10H3,(H,95,104)(H,96,105) |
| InChIKey | IFYCYXJOCMMNLO-UHFFFAOYSA-N |
| XLogP | 23.51 |
| TPSA | 199.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 81 |
| Heavy Atoms | 111 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1565.44 |
| LogP ≤ 5 | 23.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|