C64H60N2O10W — CID 169008032
bis(3,3-bis[3,4-bis(prop-2-enoxy)phenyl]indol-1-id-2-one);tungsten(2+) (PubChem CID 169008032) has the molecular formula C64H60N2O10W and a molecular weight of 1201.03 g/mol. Its IUPAC name is bis(3,3-bis[3,4-bis(prop-2-enoxy)phenyl]indol-1-id-2-one);tungsten(2+).
| Compound Name | bis(3,3-bis[3,4-bis(prop-2-enoxy)phenyl]indol-1-id-2-one);tungsten(2+) |
|---|---|
| PubChem CID | 169008032 |
| Molecular Formula | C64H60N2O10W |
| Molecular Weight | 1201.03 g/mol |
| Exact Mass | 1200.38 |
| IUPAC Name | bis(3,3-bis[3,4-bis(prop-2-enoxy)phenyl]indol-1-id-2-one);tungsten(2+) |
| SMILES | C=CCOc1ccc(C2(c3ccc(OCC=C)c(OCC=C)c3)C(=O)[N-]c3ccccc32)cc1OCC=C.C=CCOc1ccc(C2(c3ccc(OCC=C)c(OCC=C)c3)C(=O)[N-]c3ccccc32)cc1OCC=C.[W+2] |
| InChI | InChI=1S/2C32H31NO5.W/c2*1-5-17-35-27-15-13-23(21-29(27)37-19-7-3)32(25-11-9-10-12-26(25)33-31(32)34)24-14-16-28(36-18-6-2)30(22-24)38-20-8-4;/h2*5-16,21-22H,1-4,17-20H2,(H,33,34);/q;;+2/p-2 |
| InChIKey | RSBUAPWOPFUBAT-UHFFFAOYSA-L |
| XLogP | 13.65 |
| TPSA | 136.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.03 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|