C28H28Si — CID 169052978
(2,3,4,5,6-pentadeuteriophenyl)-bis[(2,3,4,5,6-pentadeuteriophenyl)methyl]-[(2,3,5,6-tetradeuterio-4-methylphenyl)methyl]silane (PubChem CID 169052978) has the molecular formula C28H28Si and a molecular weight of 411.73 g/mol. Its IUPAC name is (2,3,4,5,6-pentadeuteriophenyl)-bis[(2,3,4,5,6-pentadeuteriophenyl)methyl]-[(2,3,5,6-tetradeuterio-4-methylphenyl)methyl]silane.
| Compound Name | (2,3,4,5,6-pentadeuteriophenyl)-bis[(2,3,4,5,6-pentadeuteriophenyl)methyl]-[(2,3,5,6-tetradeuterio-4-methylphenyl)methyl]silane |
|---|---|
| PubChem CID | 169052978 |
| Molecular Formula | C28H28Si |
| Molecular Weight | 411.73 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | (2,3,4,5,6-pentadeuteriophenyl)-bis[(2,3,4,5,6-pentadeuteriophenyl)methyl]-[(2,3,5,6-tetradeuterio-4-methylphenyl)methyl]silane |
| SMILES | [2H]c1c([2H])c([2H])c(C[Si](Cc2c([2H])c([2H])c([2H])c([2H])c2[2H])(Cc2c([2H])c([2H])c(C)c([2H])c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C28H28Si/c1-24-17-19-27(20-18-24)23-29(28-15-9-4-10-16-28,21-25-11-5-2-6-12-25)22-26-13-7-3-8-14-26/h2-20H,21-23H2,1H3/i2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D,19D,20D |
| InChIKey | IKNKWZBETJZAGU-ZNWKTGLTSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.73 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|