C14H14N4O5 — CID 169097479
3-(3-methyl-6-nitro-1-oxo-4H-phthalazin-2-yl)piperidine-2,6-dione (PubChem CID 169097479) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is 3-(3-methyl-6-nitro-1-oxo-4H-phthalazin-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-methyl-6-nitro-1-oxo-4H-phthalazin-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169097479 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-(3-methyl-6-nitro-1-oxo-4H-phthalazin-2-yl)piperidine-2,6-dione |
| SMILES | CN1Cc2cc([N+](=O)[O-])ccc2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H14N4O5/c1-16-7-8-6-9(18(22)23)2-3-10(8)14(21)17(16)11-4-5-12(19)15-13(11)20/h2-3,6,11H,4-5,7H2,1H3,(H,15,19,20) |
| InChIKey | GFQBUTJRTYNGFC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|