C28H41NO — CID 169105952
(8Z)-6,8-dimethyl-7-(methylamino)-9,10-diphenylundeca-8,10-dien-4-one;ethane;molecular hydrogen (PubChem CID 169105952) has the molecular formula C28H41NO and a molecular weight of 407.64 g/mol. Its IUPAC name is (8Z)-6,8-dimethyl-7-(methylamino)-9,10-diphenylundeca-8,10-dien-4-one;ethane;molecular hydrogen.
| Compound Name | (8Z)-6,8-dimethyl-7-(methylamino)-9,10-diphenylundeca-8,10-dien-4-one;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 169105952 |
| Molecular Formula | C28H41NO |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.32 |
| IUPAC Name | (8Z)-6,8-dimethyl-7-(methylamino)-9,10-diphenylundeca-8,10-dien-4-one;ethane;molecular hydrogen |
| SMILES | C=C(/C(=C(/C)C(NC)C(C)CC(=O)CCC)c1ccccc1)c1ccccc1.CC.[H][H] |
| InChI | InChI=1S/C26H33NO.C2H6.H2/c1-6-13-24(28)18-19(2)26(27-5)21(4)25(23-16-11-8-12-17-23)20(3)22-14-9-7-10-15-22;1-2;/h7-12,14-17,19,26-27H,3,6,13,18H2,1-2,4-5H3;1-2H3;1H/b25-21+;; |
| InChIKey | WLMDIJOAMSQKSJ-WPUCSEBPSA-N |
| XLogP | 7.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|