C8H10 — CID 169129947
(3Z)-3,4-dimethylhexa-1,3-dien-5-yne (PubChem CID 169129947) has the molecular formula C8H10 and a molecular weight of 106.17 g/mol. Its IUPAC name is (3Z)-3,4-dimethylhexa-1,3-dien-5-yne.
| Compound Name | (3Z)-3,4-dimethylhexa-1,3-dien-5-yne |
|---|---|
| PubChem CID | 169129947 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | (3Z)-3,4-dimethylhexa-1,3-dien-5-yne |
| SMILES | C#C/C(C)=C(/C)C=C |
| InChI | InChI=1S/C8H10/c1-5-7(3)8(4)6-2/h1,6H,2H2,3-4H3/b8-7- |
| InChIKey | MOGNLBUMHYNBHY-FPLPWBNLSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|