C22H21N3O — CID 169130199
1-[2-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]prop-2-en-1-one (PubChem CID 169130199) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[2-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169130199 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-[2-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]prop-2-en-1-one |
| SMILES | C=C/C=C(\C=C)c1nc2c(c(-c3ccccc3)n1)CCN(C(=O)C=C)C2 |
| InChI | InChI=1S/C22H21N3O/c1-4-10-16(5-2)22-23-19-15-25(20(26)6-3)14-13-18(19)21(24-22)17-11-8-7-9-12-17/h4-12H,1-3,13-15H2/b16-10+ |
| InChIKey | RMRKMQRSXWITCL-MHWRWJLKSA-N |
| XLogP | 3.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|