C34H47N5O5 — CID 169150130
tert-butyl 4-[4-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hept-6-ynyl]piperazin-1-yl]piperidine-1-carboxylate (PubChem CID 169150130) has the molecular formula C34H47N5O5 and a molecular weight of 605.78 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hept-6-ynyl]piperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hept-6-ynyl]piperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169150130 |
| Molecular Formula | C34H47N5O5 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.36 |
| IUPAC Name | tert-butyl 4-[4-[5-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]hept-6-ynyl]piperazin-1-yl]piperidine-1-carboxylate |
| SMILES | C#CC(CCCCN1CCN(C2CCN(C(=O)OC(C)(C)C)CC2)CC1)c1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C34H47N5O5/c1-5-24(26-10-8-11-27-28(26)23-39(32(27)42)29-12-13-30(40)35-31(29)41)9-6-7-16-36-19-21-37(22-20-36)25-14-17-38(18-15-25)33(43)44-34(2,3)4/h1,8,10-11,24-25,29H,6-7,9,12-23H2,2-4H3,(H,35,40,41) |
| InChIKey | ZLCQGORJGUUSHQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|