C30H44O — CID 169180549
17-(2-ethenoxy-4,5-dimethylhex-4-enyl)-10,13-dimethyl-1-methylidene-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 169180549) has the molecular formula C30H44O and a molecular weight of 420.68 g/mol. Its IUPAC name is 17-(2-ethenoxy-4,5-dimethylhex-4-enyl)-10,13-dimethyl-1-methylidene-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | 17-(2-ethenoxy-4,5-dimethylhex-4-enyl)-10,13-dimethyl-1-methylidene-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 169180549 |
| Molecular Formula | C30H44O |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | 17-(2-ethenoxy-4,5-dimethylhex-4-enyl)-10,13-dimethyl-1-methylidene-4,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=COC(CC(C)=C(C)C)CC1CCC2C3CC=C4CC=CC(=C)C4(C)C3CCC12C |
| InChI | InChI=1S/C30H44O/c1-8-31-25(18-21(4)20(2)3)19-24-13-15-27-26-14-12-23-11-9-10-22(5)30(23,7)28(26)16-17-29(24,27)6/h8-10,12,24-28H,1,5,11,13-19H2,2-4,6-7H3 |
| InChIKey | JUKRVXUOWPRLID-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|