C10H13F2NO — CID 169183566
4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-ynal (PubChem CID 169183566) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-ynal.
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-ynal |
|---|---|
| PubChem CID | 169183566 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-ynal |
| SMILES | CC(C)(C#CC=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H13F2NO/c1-9(2,4-3-7-14)13-6-5-10(11,12)8-13/h7H,5-6,8H2,1-2H3 |
| InChIKey | NUACRSFYXZVCMZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|