C31H36F2N6O3S — CID 169197666
N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(methylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide;9,9-difluorofluorene-3-carbaldehyde;methanamine (PubChem CID 169197666) has the molecular formula C31H36F2N6O3S and a molecular weight of 610.73 g/mol. Its IUPAC name is N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(methylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide;9,9-difluorofluorene-3-carbaldehyde;methanamine.
| Compound Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(methylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide;9,9-difluorofluorene-3-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 169197666 |
| Molecular Formula | C31H36F2N6O3S |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-2-[2-(methylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide;9,9-difluorofluorene-3-carbaldehyde;methanamine |
| SMILES | CN.O=Cc1ccc2c(c1)-c1ccccc1C2(F)F.[H]/N=C(\N)c1csc([C@@H](C)NC(=O)C2CC3CC3N2C(=O)CNC)c1 |
| InChI | InChI=1S/C16H23N5O2S.C14H8F2O.CH5N/c1-8(13-5-10(7-24-13)15(17)18)20-16(23)12-4-9-3-11(9)21(12)14(22)6-19-2;15-14(16)12-4-2-1-3-10(12)11-7-9(8-17)5-6-13(11)14;1-2/h5,7-9,11-12,19H,3-4,6H2,1-2H3,(H3,17,18)(H,20,23);1-8H;2H2,1H3/t8-,9?,11?,12?;;/m1../s1 |
| InChIKey | XOCWPBPEZTYGLF-QLELNSNVSA-N |
| XLogP | 3.61 |
| TPSA | 154.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|