C31H34N8O5 — CID 169232677
8-(1-acetylpiperidin-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-nitrophenoxy)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 169232677) has the molecular formula C31H34N8O5 and a molecular weight of 598.66 g/mol. Its IUPAC name is 8-(1-acetylpiperidin-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-nitrophenoxy)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(1-acetylpiperidin-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-nitrophenoxy)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169232677 |
| Molecular Formula | C31H34N8O5 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 8-(1-acetylpiperidin-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]-6-(2-nitrophenoxy)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(=O)N1CCCC(n2c(=O)c(Oc3ccccc3[N+](=O)[O-])cc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C31H34N8O5/c1-21(40)37-13-5-6-25(20-37)38-29-22(18-28(30(38)41)44-27-8-4-3-7-26(27)39(42)43)19-32-31(34-29)33-23-9-11-24(12-10-23)36-16-14-35(2)15-17-36/h3-4,7-12,18-19,25H,5-6,13-17,20H2,1-2H3,(H,32,33,34) |
| InChIKey | MLLCIWKRINRSKH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|