C23H32ClFN6O — CID 169255964
12-chloro-7-ethyl-13-fluoro-16-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10(18),11,13,15-pentaene (PubChem CID 169255964) has the molecular formula C23H32ClFN6O and a molecular weight of 463.00 g/mol. Its IUPAC name is 12-chloro-7-ethyl-13-fluoro-16-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10(18),11,13,15-pentaene.
| Compound Name | 12-chloro-7-ethyl-13-fluoro-16-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
|---|---|
| PubChem CID | 169255964 |
| Molecular Formula | C23H32ClFN6O |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 12-chloro-7-ethyl-13-fluoro-16-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
| SMILES | CCC1CCc2nc(Cl)c(F)c3nc(OCC45CCCN4CCC5)nc(c23)NCCNC1 |
| InChI | InChI=1S/C23H32ClFN6O/c1-2-15-5-6-16-17-19(18(25)20(24)28-16)29-22(30-21(17)27-10-9-26-13-15)32-14-23-7-3-11-31(23)12-4-8-23/h15,26H,2-14H2,1H3,(H,27,29,30) |
| InChIKey | NFCASDULAAFTCI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|