C18H18F4N4O2 — CID 169281348
(4R)-4-[1-(difluoromethyl)-5-ethylpyrazol-3-yl]-N-(2,4-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 169281348) has the molecular formula C18H18F4N4O2 and a molecular weight of 398.36 g/mol. Its IUPAC name is (4R)-4-[1-(difluoromethyl)-5-ethylpyrazol-3-yl]-N-(2,4-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (4R)-4-[1-(difluoromethyl)-5-ethylpyrazol-3-yl]-N-(2,4-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 169281348 |
| Molecular Formula | C18H18F4N4O2 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (4R)-4-[1-(difluoromethyl)-5-ethylpyrazol-3-yl]-N-(2,4-difluorophenyl)-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1cc([C@H]2CN(C)C(=O)C2C(=O)Nc2ccc(F)cc2F)nn1C(F)F |
| InChI | InChI=1S/C18H18F4N4O2/c1-3-10-7-14(24-26(10)18(21)22)11-8-25(2)17(28)15(11)16(27)23-13-5-4-9(19)6-12(13)20/h4-7,11,15,18H,3,8H2,1-2H3,(H,23,27)/t11-,15?/m1/s1 |
| InChIKey | BBSFJNBFBRZMCH-ZRKZCGFPSA-N |
| XLogP | 2.93 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|