C12H11F3 — CID 169282432
1,2,3-trifluoro-5-(3-methylpenta-1,4-dien-3-yl)benzene (PubChem CID 169282432) has the molecular formula C12H11F3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-(3-methylpenta-1,4-dien-3-yl)benzene.
| Compound Name | 1,2,3-trifluoro-5-(3-methylpenta-1,4-dien-3-yl)benzene |
|---|---|
| PubChem CID | 169282432 |
| Molecular Formula | C12H11F3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1,2,3-trifluoro-5-(3-methylpenta-1,4-dien-3-yl)benzene |
| SMILES | C=CC(C)(C=C)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H11F3/c1-4-12(3,5-2)8-6-9(13)11(15)10(14)7-8/h4-7H,1-2H2,3H3 |
| InChIKey | WZVOVASAUPMAJM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|