C35H28F2NO2+ — CID 169282662
3-tert-butyl-2,5-dideuterio-6-(6-dibenzofuran-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-4-fluoro-1-methylpyridin-1-ium (PubChem CID 169282662) has the molecular formula C35H28F2NO2+ and a molecular weight of 534.62 g/mol. Its IUPAC name is 3-tert-butyl-2,5-dideuterio-6-(6-dibenzofuran-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-4-fluoro-1-methylpyridin-1-ium.
| Compound Name | 3-tert-butyl-2,5-dideuterio-6-(6-dibenzofuran-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-4-fluoro-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 169282662 |
| Molecular Formula | C35H28F2NO2+ |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 3-tert-butyl-2,5-dideuterio-6-(6-dibenzofuran-3-yl-7-fluoro-3-methyldibenzofuran-4-yl)-4-fluoro-1-methylpyridin-1-ium |
| SMILES | [2H]c1c(F)c(C(C)(C)C)c([2H])[n+](C)c1-c1c(C)ccc2c1oc1c(-c3ccc4c(c3)oc3ccccc34)c(F)ccc12 |
| InChI | InChI=1S/C35H28F2NO2/c1-19-10-12-23-24-14-15-26(36)32(20-11-13-22-21-8-6-7-9-29(21)39-30(22)16-20)34(24)40-33(23)31(19)28-17-27(37)25(18-38(28)5)35(2,3)4/h6-18H,1-5H3/q+1/i17D,18D |
| InChIKey | SBFOICKGAVGLTP-IUKNHUCNSA-N |
| XLogP | 9.53 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|