C10H6N2OTe — CID 169291467
[1,4]benzoxatellurino[2,3-b]pyrazine (PubChem CID 169291467) has the molecular formula C10H6N2OTe and a molecular weight of 297.77 g/mol. Its IUPAC name is [1,4]benzoxatellurino[2,3-b]pyrazine.
| Compound Name | [1,4]benzoxatellurino[2,3-b]pyrazine |
|---|---|
| PubChem CID | 169291467 |
| Molecular Formula | C10H6N2OTe |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | [1,4]benzoxatellurino[2,3-b]pyrazine |
| SMILES | c1ccc2c(c1)Oc1nccnc1[Te]2 |
| InChI | InChI=1S/C10H6N2OTe/c1-2-4-8-7(3-1)13-9-10(14-8)12-6-5-11-9/h1-6H |
| InChIKey | PUPQIDCMYWKCHE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|