C9H7Cl2F2NO — CID 169302904
N-[2,6-dichloro-4-(fluoromethyl)phenyl]-2-fluoroacetamide (PubChem CID 169302904) has the molecular formula C9H7Cl2F2NO and a molecular weight of 254.06 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(fluoromethyl)phenyl]-2-fluoroacetamide.
| Compound Name | N-[2,6-dichloro-4-(fluoromethyl)phenyl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 169302904 |
| Molecular Formula | C9H7Cl2F2NO |
| Molecular Weight | 254.06 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | N-[2,6-dichloro-4-(fluoromethyl)phenyl]-2-fluoroacetamide |
| SMILES | O=C(CF)Nc1c(Cl)cc(CF)cc1Cl |
| InChI | InChI=1S/C9H7Cl2F2NO/c10-6-1-5(3-12)2-7(11)9(6)14-8(15)4-13/h1-2H,3-4H2,(H,14,15) |
| InChIKey | VXIRLRDQKFWWFH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.06 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |