C32H33F6NO2 — CID 169315301
(3S,8S)-3-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 169315301) has the molecular formula C32H33F6NO2 and a molecular weight of 577.61 g/mol. Its IUPAC name is (3S,8S)-3-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (3S,8S)-3-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 169315301 |
| Molecular Formula | C32H33F6NO2 |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (3S,8S)-3-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC(OC[C@@H]1CC[C@]2(COC(c3ccccc3)(c3ccccc3)c3ccccc3)CCCN12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C32H33F6NO2/c1-28(31(33,34)35,32(36,37)38)40-22-27-18-20-29(19-11-21-39(27)29)23-41-30(24-12-5-2-6-13-24,25-14-7-3-8-15-25)26-16-9-4-10-17-26/h2-10,12-17,27H,11,18-23H2,1H3/t27-,29-/m0/s1 |
| InChIKey | XTGRNUPUTIPDMK-YTMVLYRLSA-N |
| XLogP | 7.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|