C29H34O2S — CID 169317151
2-[3-[(3,5-dimethyl-1-adamantyl)-(methoxymethoxy)methyl]phenyl]-1-benzothiophene (PubChem CID 169317151) has the molecular formula C29H34O2S and a molecular weight of 446.66 g/mol. Its IUPAC name is 2-[3-[(3,5-dimethyl-1-adamantyl)-(methoxymethoxy)methyl]phenyl]-1-benzothiophene.
| Compound Name | 2-[3-[(3,5-dimethyl-1-adamantyl)-(methoxymethoxy)methyl]phenyl]-1-benzothiophene |
|---|---|
| PubChem CID | 169317151 |
| Molecular Formula | C29H34O2S |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 2-[3-[(3,5-dimethyl-1-adamantyl)-(methoxymethoxy)methyl]phenyl]-1-benzothiophene |
| SMILES | COCOC(c1cccc(-c2cc3ccccc3s2)c1)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C29H34O2S/c1-27-13-20-14-28(2,16-27)18-29(15-20,17-27)26(31-19-30-3)23-9-6-8-21(11-23)25-12-22-7-4-5-10-24(22)32-25/h4-12,20,26H,13-19H2,1-3H3 |
| InChIKey | NJFQUQMXKAFRME-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|