C12H26O7S — CID 169323696
(2,4-dihydroxy-3,3-dimethylbutyl) 2,4-dihydroxy-3,3-dimethylbutane-1-sulfonate (PubChem CID 169323696) has the molecular formula C12H26O7S and a molecular weight of 314.40 g/mol. Its IUPAC name is (2,4-dihydroxy-3,3-dimethylbutyl) 2,4-dihydroxy-3,3-dimethylbutane-1-sulfonate.
| Compound Name | (2,4-dihydroxy-3,3-dimethylbutyl) 2,4-dihydroxy-3,3-dimethylbutane-1-sulfonate |
|---|---|
| PubChem CID | 169323696 |
| Molecular Formula | C12H26O7S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2,4-dihydroxy-3,3-dimethylbutyl) 2,4-dihydroxy-3,3-dimethylbutane-1-sulfonate |
| SMILES | CC(C)(CO)C(O)COS(=O)(=O)CC(O)C(C)(C)CO |
| InChI | InChI=1S/C12H26O7S/c1-11(2,7-13)9(15)5-19-20(17,18)6-10(16)12(3,4)8-14/h9-10,13-16H,5-8H2,1-4H3 |
| InChIKey | ZBZQHMSEDICLHK-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|