C29H26Cl3NO8 — CID 169323813
2-[4-[3-[3-[4-(2-carboxyethyl)-2-chlorophenoxy]propoxy]propoxy]-3,5-dichlorophenyl]-1,3-benzoxazole-6-carboxylic acid (PubChem CID 169323813) has the molecular formula C29H26Cl3NO8 and a molecular weight of 622.89 g/mol. Its IUPAC name is 2-[4-[3-[3-[4-(2-carboxyethyl)-2-chlorophenoxy]propoxy]propoxy]-3,5-dichlorophenyl]-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-[4-[3-[3-[4-(2-carboxyethyl)-2-chlorophenoxy]propoxy]propoxy]-3,5-dichlorophenyl]-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 169323813 |
| Molecular Formula | C29H26Cl3NO8 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | 2-[4-[3-[3-[4-(2-carboxyethyl)-2-chlorophenoxy]propoxy]propoxy]-3,5-dichlorophenyl]-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)CCc1ccc(OCCCOCCCOc2c(Cl)cc(-c3nc4ccc(C(=O)O)cc4o3)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H26Cl3NO8/c30-20-13-17(4-8-26(34)35)3-7-24(20)39-11-1-9-38-10-2-12-40-27-21(31)14-19(15-22(27)32)28-33-23-6-5-18(29(36)37)16-25(23)41-28/h3,5-7,13-16H,1-2,4,8-12H2,(H,34,35)(H,36,37) |
| InChIKey | IZBGOKMNBQDYHC-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|