C24H33Cl3FN3O5Si — CID 169323819
methyl 4-fluoro-3-[3-[5-methyl-3-[(2,2,2-trichloroethanimidoyl)oxymethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propoxy]benzoate (PubChem CID 169323819) has the molecular formula C24H33Cl3FN3O5Si and a molecular weight of 596.99 g/mol. Its IUPAC name is methyl 4-fluoro-3-[3-[5-methyl-3-[(2,2,2-trichloroethanimidoyl)oxymethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propoxy]benzoate.
| Compound Name | methyl 4-fluoro-3-[3-[5-methyl-3-[(2,2,2-trichloroethanimidoyl)oxymethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 169323819 |
| Molecular Formula | C24H33Cl3FN3O5Si |
| Molecular Weight | 596.99 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | methyl 4-fluoro-3-[3-[5-methyl-3-[(2,2,2-trichloroethanimidoyl)oxymethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propoxy]benzoate |
| SMILES | [H]/N=C(/OCc1nn(COCC[Si](C)(C)C)c(C)c1CCCOc1cc(C(=O)OC)ccc1F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C24H33Cl3FN3O5Si/c1-16-18(7-6-10-35-21-13-17(22(32)33-2)8-9-19(21)28)20(14-36-23(29)24(25,26)27)30-31(16)15-34-11-12-37(3,4)5/h8-9,13,29H,6-7,10-12,14-15H2,1-5H3/b29-23+ |
| InChIKey | GOUFKBJVZSNLLD-BYNJWEBRSA-N |
| XLogP | 6.31 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.99 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|