About 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one
6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 169352784) has the molecular formula C11H10N2O3
and a molecular weight of 218.21 g/mol. Its IUPAC name is 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 169352784 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(N=C=O)cc2NC1=O |
| InChI | InChI=1S/C11H10N2O3/c1-11(2)10(15)13-8-5-7(12-6-14)3-4-9(8)16-11/h3-5H,1-2H3,(H,13,15) |
| InChIKey | PLEHOLHUZOZZRN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CID 169352784) is 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one is CC1(C)Oc2ccc(N=C=O)cc2NC1=O.
What is the InChIKey of 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
The InChIKey is PLEHOLHUZOZZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c1-11(2)10(15)13-8-5-7(12-6-14)3-4-9(8)16-11/h3-5H,1-2H3,(H,13,15).
What are the key properties of 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one has a molecular weight of 218.21 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isocyanato-2,2-dimethyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 169352784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).