C17H14N4OS — CID 169364248
methyl N-cyano-N'-(7-methyl-9-oxo-10H-acridin-4-yl)carbamimidothioate (PubChem CID 169364248) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is methyl N-cyano-N'-(7-methyl-9-oxo-10H-acridin-4-yl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(7-methyl-9-oxo-10H-acridin-4-yl)carbamimidothioate |
|---|---|
| PubChem CID | 169364248 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | methyl N-cyano-N'-(7-methyl-9-oxo-10H-acridin-4-yl)carbamimidothioate |
| SMILES | CS/C(=N\c1cccc2c(=O)c3cc(C)ccc3[nH]c12)NC#N |
| InChI | InChI=1S/C17H14N4OS/c1-10-6-7-13-12(8-10)16(22)11-4-3-5-14(15(11)20-13)21-17(23-2)19-9-18/h3-8H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | ALTPEVYFCSAGLV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|