C36H45N5O6S — CID 169415326
(4S,7S)-17-methoxy-4-[(4-methoxyphenyl)methyl]-7-(2-methylpropyl)-9-(2-pyridin-2-ylsulfanylacetyl)-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione (PubChem CID 169415326) has the molecular formula C36H45N5O6S and a molecular weight of 675.85 g/mol. Its IUPAC name is (4S,7S)-17-methoxy-4-[(4-methoxyphenyl)methyl]-7-(2-methylpropyl)-9-(2-pyridin-2-ylsulfanylacetyl)-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione.
| Compound Name | (4S,7S)-17-methoxy-4-[(4-methoxyphenyl)methyl]-7-(2-methylpropyl)-9-(2-pyridin-2-ylsulfanylacetyl)-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione |
|---|---|
| PubChem CID | 169415326 |
| Molecular Formula | C36H45N5O6S |
| Molecular Weight | 675.85 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | (4S,7S)-17-methoxy-4-[(4-methoxyphenyl)methyl]-7-(2-methylpropyl)-9-(2-pyridin-2-ylsulfanylacetyl)-3,6,9,12-tetrazabicyclo[14.3.1]icosa-1(20),16,18-triene-2,5,11-trione |
| SMILES | COc1ccc(C[C@@H]2NC(=O)c3ccc(OC)c(c3)CCCNC(=O)CN(C(=O)CSc3ccccn3)C[C@H](CC(C)C)NC2=O)cc1 |
| InChI | InChI=1S/C36H45N5O6S/c1-24(2)18-28-21-41(34(43)23-48-33-9-5-6-16-38-33)22-32(42)37-17-7-8-26-20-27(12-15-31(26)47-4)35(44)40-30(36(45)39-28)19-25-10-13-29(46-3)14-11-25/h5-6,9-16,20,24,28,30H,7-8,17-19,21-23H2,1-4H3,(H,37,42)(H,39,45)(H,40,44)/t28-,30-/m0/s1 |
| InChIKey | UXOQQEBEIUEQJI-JDXGNMNLSA-N |
| XLogP | 3.65 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |