C24H30N2O4 — CID 169435732
methyl 1-oxido-1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-4-(N-propanoylanilino)piperidin-1-ium-4-carboxylate (PubChem CID 169435732) has the molecular formula C24H30N2O4 and a molecular weight of 415.54 g/mol. Its IUPAC name is methyl 1-oxido-1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-4-(N-propanoylanilino)piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-oxido-1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-4-(N-propanoylanilino)piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 169435732 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | methyl 1-oxido-1-[2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-4-(N-propanoylanilino)piperidin-1-ium-4-carboxylate |
| SMILES | [2H]c1c([2H])c([2H])c(CC[N+]2([O-])CCC(C(=O)OC)(N(C(=O)CC)c3ccccc3)CC2)c([2H])c1[2H] |
| InChI | InChI=1S/C24H30N2O4/c1-3-22(27)25(21-12-8-5-9-13-21)24(23(28)30-2)15-18-26(29,19-16-24)17-14-20-10-6-4-7-11-20/h4-13H,3,14-19H2,1-2H3/i4D,6D,7D,10D,11D |
| InChIKey | BFWPIZNHSVFOSV-BGCGZSDZSA-N |
| XLogP | 3.69 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|