C9H11F2NO5S — CID 169438417
(3S)-7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine;sulfuric acid (PubChem CID 169438417) has the molecular formula C9H11F2NO5S and a molecular weight of 283.25 g/mol. Its IUPAC name is (3S)-7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine;sulfuric acid.
| Compound Name | (3S)-7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine;sulfuric acid |
|---|---|
| PubChem CID | 169438417 |
| Molecular Formula | C9H11F2NO5S |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | (3S)-7,8-difluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazine;sulfuric acid |
| SMILES | C[C@H]1COc2c(ccc(F)c2F)N1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H9F2NO.H2O4S/c1-5-4-13-9-7(12-5)3-2-6(10)8(9)11;1-5(2,3)4/h2-3,5,12H,4H2,1H3;(H2,1,2,3,4)/t5-;/m0./s1 |
| InChIKey | MCXZRUHFGLVFKS-JEDNCBNOSA-N |
| XLogP | 1.50 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|