About 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate
2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate (PubChem CID 169488853) has the molecular formula C6H7F7O2S
and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate |
| PubChem CID | 169488853 |
| Molecular Formula | C6H7F7O2S |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCS(F)(F)(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7O2S/c1-2-5(14)15-3-4-16(10,11,12,13)6(7,8)9/h2H,1,3-4H2 |
| InChIKey | QUVWSGDYMUTKHG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate?
The IUPAC name of 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate (CID 169488853) is 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate.
What is the SMILES notation for 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate?
The canonical SMILES for 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate is C=CC(=O)OCCS(F)(F)(F)(F)C(F)(F)F.
What is the InChIKey of 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate?
The InChIKey is QUVWSGDYMUTKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F7O2S/c1-2-5(14)15-3-4-16(10,11,12,13)6(7,8)9/h2H,1,3-4H2.
What are the key properties of 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate?
2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate has a molecular weight of 276.17 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tetrafluoro(trifluoromethyl)-λ6-sulfanyl]ethyl prop-2-enoate is sourced from PubChem (CID 169488853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).