C21H17NO4 — CID 169492711
(9S)-9-hydroxy-7,9-dimethoxy-13-methyl-10-azapentacyclo[9.7.1.02,10.03,8.015,19]nonadeca-1,3(8),4,6,11,13,15(19),16-octaen-18-one (PubChem CID 169492711) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (9S)-9-hydroxy-7,9-dimethoxy-13-methyl-10-azapentacyclo[9.7.1.02,10.03,8.015,19]nonadeca-1,3(8),4,6,11,13,15(19),16-octaen-18-one.
| Compound Name | (9S)-9-hydroxy-7,9-dimethoxy-13-methyl-10-azapentacyclo[9.7.1.02,10.03,8.015,19]nonadeca-1,3(8),4,6,11,13,15(19),16-octaen-18-one |
|---|---|
| PubChem CID | 169492711 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (9S)-9-hydroxy-7,9-dimethoxy-13-methyl-10-azapentacyclo[9.7.1.02,10.03,8.015,19]nonadeca-1,3(8),4,6,11,13,15(19),16-octaen-18-one |
| SMILES | COc1cccc2c1[C@](O)(OC)n1c-2c2c3c(cc(C)cc31)C=CC2=O |
| InChI | InChI=1S/C21H17NO4/c1-11-9-12-7-8-15(23)18-17(12)14(10-11)22-20(18)13-5-4-6-16(25-2)19(13)21(22,24)26-3/h4-10,24H,1-3H3/t21-/m0/s1 |
| InChIKey | MXYQVPQMJGTVFT-NRFANRHFSA-N |
| XLogP | 3.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|