C29H56N2O4 — CID 170009845
3,5,5-trimethyl-N-(2-methylpropyl)-6-[2-[3,3,5-trimethyl-5-(3-methylbut-3-enoylamino)hexoxy]ethoxy]hexanamide (PubChem CID 170009845) has the molecular formula C29H56N2O4 and a molecular weight of 496.78 g/mol. Its IUPAC name is 3,5,5-trimethyl-N-(2-methylpropyl)-6-[2-[3,3,5-trimethyl-5-(3-methylbut-3-enoylamino)hexoxy]ethoxy]hexanamide.
| Compound Name | 3,5,5-trimethyl-N-(2-methylpropyl)-6-[2-[3,3,5-trimethyl-5-(3-methylbut-3-enoylamino)hexoxy]ethoxy]hexanamide |
|---|---|
| PubChem CID | 170009845 |
| Molecular Formula | C29H56N2O4 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.42 |
| IUPAC Name | 3,5,5-trimethyl-N-(2-methylpropyl)-6-[2-[3,3,5-trimethyl-5-(3-methylbut-3-enoylamino)hexoxy]ethoxy]hexanamide |
| SMILES | C=C(C)CC(=O)NC(C)(C)CC(C)(C)CCOCCOCC(C)(C)CC(C)CC(=O)NCC(C)C |
| InChI | InChI=1S/C29H56N2O4/c1-22(2)16-26(33)31-29(10,11)20-27(6,7)12-13-34-14-15-35-21-28(8,9)18-24(5)17-25(32)30-19-23(3)4/h23-24H,1,12-21H2,2-11H3,(H,30,32)(H,31,33) |
| InChIKey | KAHYUIKRWZIYLT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|