C29H57NO4 — CID 170058659
N-[5-[2-(2,2-dimethylpentoxy)propan-2-yloxy]-2,4,4-trimethylpentan-2-yl]-3,5,5-trimethyl-7-oxooctanamide (PubChem CID 170058659) has the molecular formula C29H57NO4 and a molecular weight of 483.78 g/mol. Its IUPAC name is N-[5-[2-(2,2-dimethylpentoxy)propan-2-yloxy]-2,4,4-trimethylpentan-2-yl]-3,5,5-trimethyl-7-oxooctanamide.
| Compound Name | N-[5-[2-(2,2-dimethylpentoxy)propan-2-yloxy]-2,4,4-trimethylpentan-2-yl]-3,5,5-trimethyl-7-oxooctanamide |
|---|---|
| PubChem CID | 170058659 |
| Molecular Formula | C29H57NO4 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.43 |
| IUPAC Name | N-[5-[2-(2,2-dimethylpentoxy)propan-2-yloxy]-2,4,4-trimethylpentan-2-yl]-3,5,5-trimethyl-7-oxooctanamide |
| SMILES | CCCC(C)(C)COC(C)(C)OCC(C)(C)CC(C)(C)NC(=O)CC(C)CC(C)(C)CC(C)=O |
| InChI | InChI=1S/C29H57NO4/c1-14-15-25(4,5)20-33-29(12,13)34-21-27(8,9)19-28(10,11)30-24(32)16-22(2)17-26(6,7)18-23(3)31/h22H,14-21H2,1-13H3,(H,30,32) |
| InChIKey | PFXBFRPLOHPVBE-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|