C9H13N3O3 — CID 170014967
4-aminooxy-1-(5-methyloxolan-2-yl)pyrimidin-2-one (PubChem CID 170014967) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-aminooxy-1-(5-methyloxolan-2-yl)pyrimidin-2-one.
| Compound Name | 4-aminooxy-1-(5-methyloxolan-2-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 170014967 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-aminooxy-1-(5-methyloxolan-2-yl)pyrimidin-2-one |
| SMILES | CC1CCC(n2ccc(ON)nc2=O)O1 |
| InChI | InChI=1S/C9H13N3O3/c1-6-2-3-8(14-6)12-5-4-7(15-10)11-9(12)13/h4-6,8H,2-3,10H2,1H3 |
| InChIKey | ACIVXLAKNGNVMM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|