C17H15F2N2OP — CID 170021553
N-[4-[difluoro(phosphanyl)methoxy]phenyl]-3-methylquinolin-2-amine (PubChem CID 170021553) has the molecular formula C17H15F2N2OP and a molecular weight of 332.29 g/mol. Its IUPAC name is N-[4-[difluoro(phosphanyl)methoxy]phenyl]-3-methylquinolin-2-amine.
| Compound Name | N-[4-[difluoro(phosphanyl)methoxy]phenyl]-3-methylquinolin-2-amine |
|---|---|
| PubChem CID | 170021553 |
| Molecular Formula | C17H15F2N2OP |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-[4-[difluoro(phosphanyl)methoxy]phenyl]-3-methylquinolin-2-amine |
| SMILES | Cc1cc2ccccc2nc1Nc1ccc(OC(F)(F)P)cc1 |
| InChI | InChI=1S/C17H15F2N2OP/c1-11-10-12-4-2-3-5-15(12)21-16(11)20-13-6-8-14(9-7-13)22-17(18,19)23/h2-10H,23H2,1H3,(H,20,21) |
| InChIKey | NDYUIBMXHVNHNP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|