C11H21NO5 — CID 170054834
6-tert-butyl-5,5-dimethyl-4-nitrooxane-2,3-diol (PubChem CID 170054834) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is 6-tert-butyl-5,5-dimethyl-4-nitrooxane-2,3-diol.
| Compound Name | 6-tert-butyl-5,5-dimethyl-4-nitrooxane-2,3-diol |
|---|---|
| PubChem CID | 170054834 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 6-tert-butyl-5,5-dimethyl-4-nitrooxane-2,3-diol |
| SMILES | CC(C)(C)C1OC(O)C(O)C([N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C11H21NO5/c1-10(2,3)9-11(4,5)7(12(15)16)6(13)8(14)17-9/h6-9,13-14H,1-5H3 |
| InChIKey | KARXZCLXXFAKPZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|