C43H51F2N7O4 — CID 170067452
5-[4-[4-[4-[1-[4-cyano-3-(1,1-difluoroethyl)phenyl]piperidin-4-yl]-N-methylanilino]butyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide (PubChem CID 170067452) has the molecular formula C43H51F2N7O4 and a molecular weight of 767.92 g/mol. Its IUPAC name is 5-[4-[4-[4-[1-[4-cyano-3-(1,1-difluoroethyl)phenyl]piperidin-4-yl]-N-methylanilino]butyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide.
| Compound Name | 5-[4-[4-[4-[1-[4-cyano-3-(1,1-difluoroethyl)phenyl]piperidin-4-yl]-N-methylanilino]butyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
|---|---|
| PubChem CID | 170067452 |
| Molecular Formula | C43H51F2N7O4 |
| Molecular Weight | 767.92 g/mol |
| Exact Mass | 767.40 |
| IUPAC Name | 5-[4-[4-[4-[1-[4-cyano-3-(1,1-difluoroethyl)phenyl]piperidin-4-yl]-N-methylanilino]butyl]piperazin-1-yl]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
| SMILES | Cc1ccc(N2CCN(CCCCN(C)c3ccc(C4CCN(c5ccc(C#N)c(C(C)(F)F)c5)CC4)cc3)CC2)cc1C(=O)N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C43H51F2N7O4/c1-30-6-10-35(26-37(30)42(56)52(29-53)39-14-15-40(54)47-41(39)55)51-24-22-49(23-25-51)19-5-4-18-48(3)34-11-7-31(8-12-34)32-16-20-50(21-17-32)36-13-9-33(28-46)38(27-36)43(2,44)45/h6-13,26-27,29,32,39H,4-5,14-25H2,1-3H3,(H,47,54,55) |
| InChIKey | AUDZKHMRHRFZIX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.92 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|