C11H26N2O2 — CID 170068951
3,5-diamino-7-methoxy-2,4,6-trimethylheptan-1-ol (PubChem CID 170068951) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3,5-diamino-7-methoxy-2,4,6-trimethylheptan-1-ol.
| Compound Name | 3,5-diamino-7-methoxy-2,4,6-trimethylheptan-1-ol |
|---|---|
| PubChem CID | 170068951 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 3,5-diamino-7-methoxy-2,4,6-trimethylheptan-1-ol |
| SMILES | COCC(C)C(N)C(C)C(N)C(C)CO |
| InChI | InChI=1S/C11H26N2O2/c1-7(5-14)10(12)9(3)11(13)8(2)6-15-4/h7-11,14H,5-6,12-13H2,1-4H3 |
| InChIKey | YEPBXEDJJKBBHS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |