C29H30FN5O3 — CID 170075998
(E)-N'-[4-[(1-benzyl-5-fluoroindol-2-yl)methyl]-3-oxopyrazin-2-yl]-N,N-dimethylhept-2-enediamide (PubChem CID 170075998) has the molecular formula C29H30FN5O3 and a molecular weight of 515.59 g/mol. Its IUPAC name is (E)-N'-[4-[(1-benzyl-5-fluoroindol-2-yl)methyl]-3-oxopyrazin-2-yl]-N,N-dimethylhept-2-enediamide.
| Compound Name | (E)-N'-[4-[(1-benzyl-5-fluoroindol-2-yl)methyl]-3-oxopyrazin-2-yl]-N,N-dimethylhept-2-enediamide |
|---|---|
| PubChem CID | 170075998 |
| Molecular Formula | C29H30FN5O3 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (E)-N'-[4-[(1-benzyl-5-fluoroindol-2-yl)methyl]-3-oxopyrazin-2-yl]-N,N-dimethylhept-2-enediamide |
| SMILES | CN(C)C(=O)/C=C/CCCC(=O)Nc1nccn(Cc2cc3cc(F)ccc3n2Cc2ccccc2)c1=O |
| InChI | InChI=1S/C29H30FN5O3/c1-33(2)27(37)12-8-4-7-11-26(36)32-28-29(38)34(16-15-31-28)20-24-18-22-17-23(30)13-14-25(22)35(24)19-21-9-5-3-6-10-21/h3,5-6,8-10,12-18H,4,7,11,19-20H2,1-2H3,(H,31,32,36)/b12-8+ |
| InChIKey | JYRHLXCAGYBWKD-XYOKQWHBSA-N |
| XLogP | 4.19 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|