C20H30N4O5S — CID 170086648
(4R)-4-amino-2-[(E)-N-butoxy-C-methylcarbonimidoyl]-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 170086648) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is (4R)-4-amino-2-[(E)-N-butoxy-C-methylcarbonimidoyl]-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-4-amino-2-[(E)-N-butoxy-C-methylcarbonimidoyl]-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 170086648 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (4R)-4-amino-2-[(E)-N-butoxy-C-methylcarbonimidoyl]-N-[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | CCCCO/N=C(\C)C1=N[C@](N)(C(=O)N[C@H](CCC)c2cc(OC)cc(=O)o2)CS1 |
| InChI | InChI=1S/C20H30N4O5S/c1-5-7-9-28-24-13(3)18-23-20(21,12-30-18)19(26)22-15(8-6-2)16-10-14(27-4)11-17(25)29-16/h10-11,15H,5-9,12,21H2,1-4H3,(H,22,26)/b24-13+/t15-,20+/m1/s1 |
| InChIKey | JQSCINPAGFQSPA-SHDNMAGDSA-N |
| XLogP | 2.60 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|