C19H28N4O5S — CID 154956560
(4R)-4-amino-N-[(1R)-1-(4-butoxy-6-oxopyran-2-yl)butyl]-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 154956560) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is (4R)-4-amino-N-[(1R)-1-(4-butoxy-6-oxopyran-2-yl)butyl]-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-4-amino-N-[(1R)-1-(4-butoxy-6-oxopyran-2-yl)butyl]-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154956560 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (4R)-4-amino-N-[(1R)-1-(4-butoxy-6-oxopyran-2-yl)butyl]-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | CCCCOc1cc([C@@H](CCC)NC(=O)[C@]2(N)CSC(/C(C)=N\O)=N2)oc(=O)c1 |
| InChI | InChI=1S/C19H28N4O5S/c1-4-6-8-27-13-9-15(28-16(24)10-13)14(7-5-2)21-18(25)19(20)11-29-17(22-19)12(3)23-26/h9-10,14,26H,4-8,11,20H2,1-3H3,(H,21,25)/b23-12-/t14-,19+/m1/s1 |
| InChIKey | GOYQEJSHCDXQRX-FSUBPGJUSA-N |
| XLogP | 2.43 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|