C18H23N3O5S — CID 162784740
(4R)-N-[(1R)-1-(4-ethenoxy-6-oxopyran-2-yl)butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide (PubChem CID 162784740) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is (4R)-N-[(1R)-1-(4-ethenoxy-6-oxopyran-2-yl)butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-N-[(1R)-1-(4-ethenoxy-6-oxopyran-2-yl)butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162784740 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (4R)-N-[(1R)-1-(4-ethenoxy-6-oxopyran-2-yl)butyl]-2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
| SMILES | C=COc1cc([C@@H](CCC)NC(=O)[C@]2(C)CSC(/C(C)=N/O)=N2)oc(=O)c1 |
| InChI | InChI=1S/C18H23N3O5S/c1-5-7-13(14-8-12(25-6-2)9-15(22)26-14)19-17(23)18(4)10-27-16(20-18)11(3)21-24/h6,8-9,13,24H,2,5,7,10H2,1,3-4H3,(H,19,23)/b21-11+/t13-,18+/m1/s1 |
| InChIKey | IEKADHNYTNMELP-JTBLNTBXSA-N |
| XLogP | 2.87 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|