C19H27N3O5S — CID 166980168
2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide (PubChem CID 166980168) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166980168 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOC1=CC(O)OC([C@@H](CCC)NC(=O)C2(C)CSC(/C(C)=N/O)=N2)=C1 |
| InChI | InChI=1S/C19H27N3O5S/c1-5-7-14(15-9-13(26-8-6-2)10-16(23)27-15)20-18(24)19(4)11-28-17(21-19)12(3)22-25/h6,9-10,14,16,23,25H,2,5,7-8,11H2,1,3-4H3,(H,20,24)/b22-12+/t14-,16?,19?/m1/s1 |
| InChIKey | ITRBIYFILVWWQA-HKFWFNSASA-N |
| XLogP | 2.34 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|