C27H39N3O8S — CID 162784677
(4R)-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 162784677) has the molecular formula C27H39N3O8S and a molecular weight of 565.69 g/mol. Its IUPAC name is (4R)-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162784677 |
| Molecular Formula | C27H39N3O8S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | (4R)-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOc1cc([C@@H](CCC)NC(=O)[C@]2(C)CSC(/C(C)=N/CC(=O)COCCOCCOC)=N2)oc(=O)c1 |
| InChI | InChI=1S/C27H39N3O8S/c1-6-8-22(23-14-21(37-9-7-2)15-24(32)38-23)29-26(33)27(4)18-39-25(30-27)19(3)28-16-20(31)17-36-13-12-35-11-10-34-5/h7,14-15,22H,2,6,8-13,16-18H2,1,3-5H3,(H,29,33)/b28-19+/t22-,27+/m1/s1 |
| InChIKey | VRSFDVSJPQFDSK-AYBVBNPHSA-N |
| XLogP | 2.78 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|