C19H13F5NO2PS — CID 170107016
2,2-difluoro-7-phosphanyl-4-prop-2-ynyl-6-(2,3,6-trifluoro-5-methyl-4-methylsulfanylphenyl)-1,4-benzoxazin-3-one (PubChem CID 170107016) has the molecular formula C19H13F5NO2PS and a molecular weight of 445.35 g/mol. Its IUPAC name is 2,2-difluoro-7-phosphanyl-4-prop-2-ynyl-6-(2,3,6-trifluoro-5-methyl-4-methylsulfanylphenyl)-1,4-benzoxazin-3-one.
| Compound Name | 2,2-difluoro-7-phosphanyl-4-prop-2-ynyl-6-(2,3,6-trifluoro-5-methyl-4-methylsulfanylphenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170107016 |
| Molecular Formula | C19H13F5NO2PS |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 2,2-difluoro-7-phosphanyl-4-prop-2-ynyl-6-(2,3,6-trifluoro-5-methyl-4-methylsulfanylphenyl)-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)C(F)(F)Oc2cc(P)c(-c3c(F)c(C)c(SC)c(F)c3F)cc21 |
| InChI | InChI=1S/C19H13F5NO2PS/c1-4-5-25-10-6-9(12(28)7-11(10)27-19(23,24)18(25)26)13-14(20)8(2)17(29-3)16(22)15(13)21/h1,6-7H,5,28H2,2-3H3 |
| InChIKey | GQJHHSNILFGPIU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|