C9H9BrO — CID 170124867
(2Z,3Z)-2-(1-bromoprop-2-enylidene)hexa-3,5-dienal (PubChem CID 170124867) has the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-bromoprop-2-enylidene)hexa-3,5-dienal.
| Compound Name | (2Z,3Z)-2-(1-bromoprop-2-enylidene)hexa-3,5-dienal |
|---|---|
| PubChem CID | 170124867 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | (2Z,3Z)-2-(1-bromoprop-2-enylidene)hexa-3,5-dienal |
| SMILES | C=C/C=C\C(C=O)=C(\Br)C=C |
| InChI | InChI=1S/C9H9BrO/c1-3-5-6-8(7-11)9(10)4-2/h3-7H,1-2H2/b6-5-,9-8- |
| InChIKey | LDJZHUSHKVEKOP-AFJQJTPPSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|